EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34O5 |
| Net Charge | 0 |
| Average Mass | 474.597 |
| Monoisotopic Mass | 474.24062 |
| SMILES | CC(C)=CCc1cc([C@@H]2CC(=O)c3c(O)cc(O)c(CC=C(C)C)c3O2)cc2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C30H34O5/c1-17(2)7-9-19-13-21(14-20-11-12-30(5,6)35-28(19)20)26-16-25(33)27-24(32)15-23(31)22(29(27)34-26)10-8-18(3)4/h7-8,11-15,26,31-32H,9-10,16H2,1-6H3/t26-/m0/s1 |
| InChIKey | WWMWKWWJSMMNPL-SANMLTNESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Maackia amurensis (ncbitaxon:37501) | stem (BTO:0001300) | PubMed (19252325) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maackiaflavanone B (CHEBI:66644) has role antineoplastic agent (CHEBI:35610) |
| maackiaflavanone B (CHEBI:66644) has role metabolite (CHEBI:25212) |
| maackiaflavanone B (CHEBI:66644) is a dihydroxyflavanone (CHEBI:38749) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-2',2'-dimethyl-8,8'-bis(3-methylbut-2-en-1-yl)-2,3-dihydro-2'H,4H-2,6'-bichromen-4-one |
| Synonym | Source |
|---|---|
| (2S)-5,7-dihydroxy-3',8-di(3-methylbut-2-enyl)-2'',2''-dimethylpyrano[5'',6'':5',4']flavanone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CN101434592 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19598949 | Reaxys |
| Citations |
|---|