EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O6 |
| Net Charge | 0 |
| Average Mass | 436.504 |
| Monoisotopic Mass | 436.18859 |
| SMILES | COc1cc(O)c2c(c1CC=C(C)C)O[C@H](c1cc3c(cc1O)OC(C)(C)C=C3)CC2=O |
| InChI | InChI=1S/C26H28O6/c1-14(2)6-7-16-22(30-5)12-19(28)24-20(29)13-23(31-25(16)24)17-10-15-8-9-26(3,4)32-21(15)11-18(17)27/h6,8-12,23,27-28H,7,13H2,1-5H3/t23-/m0/s1 |
| InChIKey | SMMHWUYJGIKYEW-QHCPKHFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Maackia amurensis (ncbitaxon:37501) | stem (BTO:0001300) | PubMed (19252325) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maackiaflavanone A (CHEBI:66643) has role antineoplastic agent (CHEBI:35610) |
| maackiaflavanone A (CHEBI:66643) has role metabolite (CHEBI:25212) |
| maackiaflavanone A (CHEBI:66643) is a dihydroxyflavanone (CHEBI:38749) |
| maackiaflavanone A (CHEBI:66643) is a monomethoxyflavanone (CHEBI:38738) |
| IUPAC Name |
|---|
| (2S)-5,7'-dihydroxy-7-methoxy-2',2'-dimethyl-8-(3-methylbut-2-en-1-yl)-2,3-dihydro-2'H,4H-2,6'-bichromen-4-one |
| Synonym | Source |
|---|---|
| (2S)-5,2'-dihydroxy-7-methoxy-8-(3-methylbut-2-enyl)-2''',2'''-dimethylpyrano[5''',6''':5',4'] | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CN101434592 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19598947 | Reaxys |
| Citations |
|---|