EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36O6 |
| Net Charge | 0 |
| Average Mass | 492.612 |
| Monoisotopic Mass | 492.25119 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c([C@@H]2CC(=O)c3c(cc(O)c(CC=C(C)C)c3O)O2)ccc(O)c1O |
| InChI | InChI=1S/C30H36O6/c1-17(2)7-6-8-19(5)10-12-21-20(13-14-23(31)29(21)34)26-16-25(33)28-27(36-26)15-24(32)22(30(28)35)11-9-18(3)4/h7,9-10,13-15,26,31-32,34-35H,6,8,11-12,16H2,1-5H3/b19-10+/t26-/m0/s1 |
| InChIKey | SZHDIKOQLFZADP-XBPZWBIKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga tanarius (ncbitaxon:109849) | leaf (BTO:0000713) | PubMed (15974621) | |
| Hernandia nymphaeifolia (ncbitaxon:121082) | - | DOI (10.3987/R-1980-04-0397) | |
| Propolis (Okinawa, Japan) | - | PubMed (14745198) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nymphaeol C (CHEBI:66642) has role metabolite (CHEBI:25212) |
| nymphaeol C (CHEBI:66642) has role radical scavenger (CHEBI:48578) |
| nymphaeol C (CHEBI:66642) is a 4'-hydroxyflavanones (CHEBI:140331) |
| nymphaeol C (CHEBI:66642) is a tetrahydroxyflavanone (CHEBI:38742) |
| IUPAC Name |
|---|
| (2S)-2-{2-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-3,4-dihydroxyphenyl}-5,7-dihydroxy-6-(3-methylbut-2-en-1-yl)-2,3-dihydro-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6024890 | Reaxys |
| Citations |
|---|