EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H30O17 |
| Net Charge | 0 |
| Average Mass | 650.542 |
| Monoisotopic Mass | 650.14830 |
| SMILES | O=C(O)CC(=O)OC[C@H]1O[C@@H](Oc2cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc3c2)[C@H](O[C@@H]2OC[C@](O)(CO)[C@H]2O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H30O17/c30-10-29(40)11-42-28(26(29)39)46-25-24(38)23(37)19(9-41-21(36)8-20(34)35)45-27(25)43-14-5-15(32)22-16(33)7-17(44-18(22)6-14)12-1-3-13(31)4-2-12/h1-7,19,23-28,30-32,37-40H,8-11H2,(H,34,35)/t19-,23-,24+,25-,26+,27-,28+,29-/m1/s1 |
| InChIKey | JNAHTYWPEQLJRT-CQRLEKJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petroselinum crispum (ncbitaxon:4043) | leaf (BTO:0000713) | PubMed (18214349) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malonylapiin (CHEBI:6664) has functional parent apiin (CHEBI:15932) |
| malonylapiin (CHEBI:6664) has role plant metabolite (CHEBI:76924) |
| malonylapiin (CHEBI:6664) is a dihydroxyflavone (CHEBI:38686) |
| malonylapiin (CHEBI:6664) is a disaccharide derivative (CHEBI:63353) |
| malonylapiin (CHEBI:6664) is a glycosyloxyflavone (CHEBI:50018) |
| malonylapiin (CHEBI:6664) is a malonate ester (CHEBI:38083) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-7-yl 6-O-(carboxyacetyl)-2-O-[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 7-O-[beta-D-apiosyl-(1->2)-(6-malonyl-beta-D-glucoside)] | KEGG COMPOUND |
| 6''-Malonylapiin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C05622 | KEGG COMPOUND |
| HMDB0037601 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6627061 | Reaxys |
| Citations |
|---|