EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N2O2 |
| Net Charge | 0 |
| Average Mass | 178.191 |
| Monoisotopic Mass | 178.07423 |
| SMILES | CC(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C9H10N2O2/c1-6(12)11-8-5-3-2-4-7(8)9(10)13/h2-5H,1H3,(H2,10,13)(H,11,12) |
| InChIKey | WFKPHYKFAOXUTI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces aurantiogriseus (ncbitaxon:66870) | - | PubMed (8784436) | Strain: NPO 101 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NP-101A (CHEBI:66639) has role antifungal agent (CHEBI:35718) |
| NP-101A (CHEBI:66639) has role antimicrobial agent (CHEBI:33281) |
| NP-101A (CHEBI:66639) has role metabolite (CHEBI:25212) |
| NP-101A (CHEBI:66639) is a acetamides (CHEBI:22160) |
| NP-101A (CHEBI:66639) is a benzamides (CHEBI:22702) |
| IUPAC Name |
|---|
| 2-(acetylamino)benzamide |
| Synonyms | Source |
|---|---|
| o-acetamidobenzamide | ChEBI |
| 2-acetamidobenzamide | ChEBI |
| N-acetylanthranilamide | ChEBI |
| Acetanilide, 2'-carbamoyl- (6CI,8CI) | ChemIDplus |
| 2'-carbamoylacetanilide | ChEBI |
| N-acetyl-anthranilic acid amide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2210851 | Reaxys |
| CAS:33809-77-7 | ChemIDplus |
| Citations |
|---|