EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H37NO11 |
| Net Charge | 0 |
| Average Mass | 587.622 |
| Monoisotopic Mass | 587.23666 |
| SMILES | COc1ccc(O)c2c1C(=O)c1cc3c(c(O)c1C2=O)C(OC1CC(C)(N(C)C)C(O)C(C)O1)C(OC)C(C)(O)C3O |
| InChI | InChI=1S/C30H37NO11/c1-12-26(36)29(2,31(4)5)11-17(41-12)42-25-19-14(27(37)30(3,38)28(25)40-7)10-13-18(23(19)34)24(35)20-15(32)8-9-16(39-6)21(20)22(13)33/h8-10,12,17,25-28,32,34,36-38H,11H2,1-7H3 |
| InChIKey | XXHMZNPASHQZPM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardia (ncbitaxon:1821) | - | PubMed (9544933) | Strain: MJ896-43F17 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nothramicin (CHEBI:66638) has role antimycobacterial drug (CHEBI:64912) |
| nothramicin (CHEBI:66638) is a aminoglycoside (CHEBI:47779) |
| nothramicin (CHEBI:66638) is a anthracycline antibiotic (CHEBI:49322) |
| nothramicin (CHEBI:66638) is a aromatic ether (CHEBI:35618) |
| nothramicin (CHEBI:66638) is a deoxy hexoside (CHEBI:35315) |
| nothramicin (CHEBI:66638) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3,4,10,12-tetrahydroxy-2,7-dimethoxy-3-methyl-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 2,3,6-trideoxy-3-(dimethylamino)-3-methylhexopyranoside |
| Registry Numbers | Sources |
|---|---|
| CAS:205752-47-2 | ChemIDplus |
| Citations |
|---|