EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18N2O3 |
| Net Charge | 0 |
| Average Mass | 334.375 |
| Monoisotopic Mass | 334.13174 |
| SMILES | COc1ccc(CC(C#N)/C(C#N)=C/c2ccc(OC)c(O)c2)cc1 |
| InChI | InChI=1S/C20H18N2O3/c1-24-18-6-3-14(4-7-18)9-16(12-21)17(13-22)10-15-5-8-20(25-2)19(23)11-15/h3-8,10-11,16,23H,9H2,1-2H3/b17-10+ |
| InChIKey | OSJAZSFVURTOLX-LICLKQGHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neosartorya fischeri (ncbitaxon:36630) | - | PubMed (7844048) | Strain: IFO9857 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NK372135C (CHEBI:66633) has role antifungal agent (CHEBI:35718) |
| NK372135C (CHEBI:66633) has role fungal metabolite (CHEBI:76946) |
| NK372135C (CHEBI:66633) is a dinitrile (CHEBI:51308) |
| NK372135C (CHEBI:66633) is a guaiacols (CHEBI:134251) |
| IUPAC Name |
|---|
| (2Z)-2-(3-hydroxy-4-methoxybenzylidene)-3-(4-methoxybenzyl)butanedinitrile |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7145038 | Reaxys |
| Citations |
|---|