EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H70O13 |
| Net Charge | 0 |
| Average Mass | 770.998 |
| Monoisotopic Mass | 770.48164 |
| SMILES | CCC(O)CC1CCCC2(CC3OC(=O)/C=C/C(C)(O)C(O)C(C)C(O)C(O)C(O)C(C)(O)CCCCC/C=C/C4CC(C)(C)OC4(O)CC(O2)C3C)O1 |
| InChI | InChI=1S/C41H70O13/c1-8-28(42)21-29-16-14-19-40(52-29)23-30-25(2)31(53-40)24-41(50)27(22-37(4,5)54-41)15-12-10-9-11-13-18-38(6,48)36(47)34(45)33(44)26(3)35(46)39(7,49)20-17-32(43)51-30/h12,15,17,20,25-31,33-36,42,44-50H,8-11,13-14,16,18-19,21-24H2,1-7H3/b15-12+,20-17+ |
| InChIKey | ZACXIZMUUXGJHL-QTBZMJKBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (9031676) | Strain: NK154183 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NK154183A (CHEBI:66629) has role antifungal agent (CHEBI:35718) |
| NK154183A (CHEBI:66629) has role antineoplastic agent (CHEBI:35610) |
| NK154183A (CHEBI:66629) has role metabolite (CHEBI:25212) |
| NK154183A (CHEBI:66629) is a cyclic hemiketal (CHEBI:59780) |
| NK154183A (CHEBI:66629) is a macrolide antibiotic (CHEBI:25105) |
| NK154183A (CHEBI:66629) is a secondary alcohol (CHEBI:35681) |
| NK154183A (CHEBI:66629) is a spiroketal (CHEBI:72600) |
| NK154183A (CHEBI:66629) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (4E,18E)-11,12,13,14,16,17,27a-heptahydroxy-6'-(2-hydroxybutyl)-2,2,11,15,17,28-hexamethyl-2,3,3',3a,4',5',6,6',7,8,9,10,11,12,13,14,15,16,17,22,23,26,27,27a-tetracosahydro-20H-spiro[22,26-methanofuro[2,3-h][1,5]dioxacyclohexacosine-24,2'-pyran]-20-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8181910 | Reaxys |
| CAS:152986-47-5 | ChemIDplus |
| Citations |
|---|