EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@@]12CC[C@@H](C(=C)C)[C@@]3(CCC(=O)O)C[C@]31CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CC/C=C(/C)C(=O)O |
| InChI | InChI=1S/C30H46O4/c1-19(2)22-10-11-24-28(6)14-12-23(20(3)8-7-9-21(4)26(33)34)27(28,5)16-17-30(24)18-29(22,30)15-13-25(31)32/h9,20,22-24H,1,7-8,10-18H2,2-6H3,(H,31,32)(H,33,34)/b21-9-/t20-,22+,23-,24+,27-,28+,29-,30+/m1/s1 |
| InChIKey | NJFOSFIPGRXARF-BRTULJEKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura heteroclita (IPNI:554576-1) | stem (BTO:0001300) | PubMed (16557460) | |
| Schisandra henryi (ncbitaxon:124789) | stem (BTO:0001300) | PubMed (14661856) | |
| Schisandra propinqua (ncbitaxon:124790) | stem (BTO:0001300) | PubMed (11395273) | |
| Schisandra sphaerandra (IPNI:555079-1) | stem (BTO:0001300) | PubMed (8778243) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigranoic acid (CHEBI:66626) has role antineoplastic agent (CHEBI:35610) |
| nigranoic acid (CHEBI:66626) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| nigranoic acid (CHEBI:66626) has role metabolite (CHEBI:25212) |
| nigranoic acid (CHEBI:66626) is a dicarboxylic acid (CHEBI:35692) |
| nigranoic acid (CHEBI:66626) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (2Z,6R)-6-[(1R,3aS,3bS,6S,6aR,7aS,9aR)-6a-(2-carboxyethyl)-3a,9a-dimethyl-6-(prop-1-en-2-yl)dodecahydro-1H-cyclopenta[a]cyclopropa[e]naphthalen-1-yl]-2-methylhept-2-enoic acid |
| Synonym | Source |
|---|---|
| 3,4-secocycloarta-4(28),24-(Z)-diene-3,26-dioic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2314904 | Reaxys |
| CAS:39111-07-4 | ChemIDplus |
| Citations |
|---|