EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N2O3 |
| Net Charge | 0 |
| Average Mass | 270.288 |
| Monoisotopic Mass | 270.10044 |
| SMILES | COC1=CC(=O)C=C/C1=N\NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H14N2O3/c1-20-14-10-12(18)7-8-13(14)16-17-15(19)9-11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,17,19)/b16-13+ |
| InChIKey | RVUBDWIQXQBPBE-DTQAZKPQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium minioluteum (ncbitaxon:28574) | - | PubMed (10348036) | Strain: F 4627 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. nerve growth factor stimulator Any molecule shown to have the potentiality in stimulating the effect of nerve growth factor. |
| Application: | nerve growth factor stimulator Any molecule shown to have the potentiality in stimulating the effect of nerve growth factor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NG-061 (CHEBI:66624) has functional parent 1,4-benzoquinone imine (CHEBI:50192) |
| NG-061 (CHEBI:66624) has role Penicillium metabolite (CHEBI:76964) |
| NG-061 (CHEBI:66624) has role nerve growth factor stimulator (CHEBI:72294) |
| NG-061 (CHEBI:66624) is a carbohydrazide (CHEBI:35363) |
| NG-061 (CHEBI:66624) is a hydrazone (CHEBI:38532) |
| NG-061 (CHEBI:66624) is a quinone imine (CHEBI:50193) |
| IUPAC Name |
|---|
| N'-[(1E)-2-methoxy-4-oxocyclohexa-2,5-dien-1-ylidene]-2-phenylacetohydrazide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8326621 | Reaxys |
| Citations |
|---|