EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C56H42O12 |
| Net Charge | 0 |
| Average Mass | 906.940 |
| Monoisotopic Mass | 906.26763 |
| SMILES | [H][C@]12c3cc(O)cc(O)c3[C@@H](c3ccc(O)cc3)[C@]([H])([C@]3([H])c4cc(O)cc5c4[C@]([H])(c4cc(O)cc(O)c4[C@H]3c3ccc(O)cc3)[C@@H](c3ccc(O)cc3)O5)c3cc(O)cc(c31)O[C@@H]2c1ccc(O)cc1 |
| InChI | InChI=1S/C56H42O12/c57-29-9-1-25(2-10-29)45-47-37(17-33(61)21-41(47)65)53-49-39(19-35(63)23-43(49)67-55(53)27-5-13-31(59)14-6-27)51(45)52-40-20-36(64)24-44-50(40)54(56(68-44)28-7-15-32(60)16-8-28)38-18-34(62)22-42(66)48(38)46(52)26-3-11-30(58)12-4-26/h1-24,45-46,51-66H/t45-,46-,51-,52-,53+,54+,55-,56-/m1/s1 |
| InChIKey | YQQUILZPDYJDQJ-RNDSKEHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kobresia nepalensis (ncbitaxon:58223) | stem (BTO:0001300) | PubMed (16508191) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nepalensinol F (CHEBI:66618) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| nepalensinol F (CHEBI:66618) has role metabolite (CHEBI:25212) |
| nepalensinol F (CHEBI:66618) is a cyclic ether (CHEBI:37407) |
| nepalensinol F (CHEBI:66618) is a organic heterotetracyclic compound (CHEBI:38163) |
| nepalensinol F (CHEBI:66618) is a polyphenol (CHEBI:26195) |
| nepalensinol F (CHEBI:66618) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| (1S,1'S,6S,6'S,7R,7'R,11bS,11b'S)-1,1',7,7'-tetrakis(4-hydroxyphenyl)-1,1',6,6',7,7',11b,11b'-octahydro-6,6'-bi-2-oxadibenzo[cd,h]azulene-4,4',8,8',10,10'-hexol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10415816 | Reaxys |
| Citations |
|---|