EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C56H44O13 |
| Net Charge | 0 |
| Average Mass | 924.955 |
| Monoisotopic Mass | 924.27819 |
| SMILES | Oc1ccc([C@H]2O[C@@H](c3ccc(O)cc3)[C@H](c3cc4c(cc3O)O[C@@H](c3ccc(O)cc3)[C@@H]4c3cc4c(cc3O)O[C@@H](c3ccc(O)cc3)[C@@H]4c3cc(O)cc(O)c3)[C@@H]2c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C56H44O13/c57-33-9-1-27(2-10-33)53-49(31-17-37(61)21-38(62)18-31)43-23-41(45(65)25-47(43)67-53)51-44-24-42(46(66)26-48(44)68-55(51)29-5-13-35(59)14-6-29)52-50(32-19-39(63)22-40(64)20-32)54(28-3-11-34(58)12-4-28)69-56(52)30-7-15-36(60)16-8-30/h1-26,49-66H/t49-,50+,51-,52-,53+,54-,55+,56+/m1/s1 |
| InChIKey | LQIPZGZUEUXKIL-XLTULDRDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kobresia nepalensis (ncbitaxon:58223) | stem (BTO:0001300) | PubMed (16508191) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nepalensinol E (CHEBI:66617) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| nepalensinol E (CHEBI:66617) has role metabolite (CHEBI:25212) |
| nepalensinol E (CHEBI:66617) is a 1-benzofurans (CHEBI:38830) |
| nepalensinol E (CHEBI:66617) is a polyphenol (CHEBI:26195) |
| nepalensinol E (CHEBI:66617) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| (2R,2'R,3R,3'R)-3'-(3,5-dihydroxyphenyl)-5-[(2R,3S,4R,5S)-4-(3,5-dihydroxyphenyl)-2,5-bis(4-hydroxyphenyl)tetrahydrofuran-3-yl]-2,2'-bis(4-hydroxyphenyl)-2,2',3,3'-tetrahydro-3,5'-bi-1-benzofuran-6,6'-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10415756 | Reaxys |
| Citations |
|---|