EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H34O10 |
| Net Charge | 0 |
| Average Mass | 698.724 |
| Monoisotopic Mass | 698.21520 |
| SMILES | Oc1ccc([C@H]2O[C@H](c3ccc(O)cc3)[C@@H](c3cc(O)cc(O)c3)[C@H]2c2cc3c(cc2O)O[C@@H](c2ccc(O)cc2)[C@@H]3c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C42H34O10/c43-26-7-1-21(2-8-26)40-37(24-13-29(46)17-30(47)14-24)34-19-33(35(50)20-36(34)51-40)39-38(25-15-31(48)18-32(49)16-25)41(22-3-9-27(44)10-4-22)52-42(39)23-5-11-28(45)12-6-23/h1-20,37-50H/t37-,38+,39-,40+,41-,42-/m1/s1 |
| InChIKey | MYLPJMHAHFPCII-HQOKTICZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kobresia nepalensis (ncbitaxon:58223) | stem (BTO:0001300) | PubMed (16508191) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nepalensinol D (CHEBI:66616) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| nepalensinol D (CHEBI:66616) has role metabolite (CHEBI:25212) |
| nepalensinol D (CHEBI:66616) is a 1-benzofurans (CHEBI:38830) |
| nepalensinol D (CHEBI:66616) is a polyphenol (CHEBI:26195) |
| nepalensinol D (CHEBI:66616) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| 5-[(2R,3R)-5-[(2S,3S,4R,5S)-4-(3,5-dihydroxyphenyl)-2,5-bis(4-hydroxyphenyl)tetrahydrofuran-3-yl]-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-yl]benzene-1,3-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10413768 | Reaxys |
| Citations |
|---|