EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H34O10 |
| Net Charge | 0 |
| Average Mass | 698.724 |
| Monoisotopic Mass | 698.21520 |
| SMILES | Oc1ccc([C@H]2O[C@H](c3ccc(O)cc3)[C@@H](c3cc(O)cc(O)c3)[C@H]2c2cc3c(cc2O)O[C@@H](c2ccc(O)cc2)[C@@H]3c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C42H34O10/c43-26-7-1-21(2-8-26)40-37(24-13-29(46)17-30(47)14-24)34-19-33(35(50)20-36(34)51-40)39-38(25-15-31(48)18-32(49)16-25)41(22-3-9-27(44)10-4-22)52-42(39)23-5-11-28(45)12-6-23/h1-20,37-50H/t37-,38+,39-,40+,41-,42-/m1/s1 |
| InChIKey | MYLPJMHAHFPCII-HQOKTICZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kobresia nepalensis (ncbitaxon:58223) | stem (BTO:0001300) | PubMed (16508191) |
| Roles Classification |
|---|
| Biological Roles: | EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nepalensinol D (CHEBI:66616) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| nepalensinol D (CHEBI:66616) has role metabolite (CHEBI:25212) |
| nepalensinol D (CHEBI:66616) is a 1-benzofurans (CHEBI:38830) |
| nepalensinol D (CHEBI:66616) is a polyphenol (CHEBI:26195) |
| nepalensinol D (CHEBI:66616) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| 5-[(2R,3R)-5-[(2S,3S,4R,5S)-4-(3,5-dihydroxyphenyl)-2,5-bis(4-hydroxyphenyl)tetrahydrofuran-3-yl]-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-yl]benzene-1,3-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10413768 | Reaxys |
| Citations |
|---|