EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H3Cl6NO |
| Net Charge | 0 |
| Average Mass | 365.858 |
| Monoisotopic Mass | 362.83458 |
| SMILES | Oc1cc(Cl)c(Cl)c(Cl)c1-n1cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C10H3Cl6NO/c11-3-1-5(18)9(8(15)6(3)13)17-2-4(12)7(14)10(17)16/h1-2,18H |
| InChIKey | NTKHEOJBPXFULD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (19191549) | Strain: AMRI 33844 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neopyrrolomycin B (CHEBI:66615) has role antibacterial agent (CHEBI:33282) |
| neopyrrolomycin B (CHEBI:66615) has role antimicrobial agent (CHEBI:33281) |
| neopyrrolomycin B (CHEBI:66615) has role metabolite (CHEBI:25212) |
| neopyrrolomycin B (CHEBI:66615) is a pyrroles (CHEBI:26455) |
| neopyrrolomycin B (CHEBI:66615) is a trichlorophenols (CHEBI:15258) |
| IUPAC Name |
|---|
| 3,4,5-trichloro-2-(2,3,4-trichloro-1H-pyrrol-1-yl)phenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19103289 | Reaxys |
| Citations |
|---|