EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O4 |
| Net Charge | 0 |
| Average Mass | 322.360 |
| Monoisotopic Mass | 322.12051 |
| SMILES | CC(C)=CCc1cc(-c2coc3cc(O)ccc3c2=O)ccc1O |
| InChI | InChI=1S/C20H18O4/c1-12(2)3-4-14-9-13(5-8-18(14)22)17-11-24-19-10-15(21)6-7-16(19)20(17)23/h3,5-11,21-22H,4H2,1-2H3 |
| InChIKey | OBGPEBYHGIUFBN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Psoralea corylifolia (ncbitaxon:429560) | seed (BTO:0001226) | PubMed (8759164) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neobavaisoflavone (CHEBI:66614) has role antineoplastic agent (CHEBI:35610) |
| neobavaisoflavone (CHEBI:66614) has role EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor (CHEBI:131699) |
| neobavaisoflavone (CHEBI:66614) has role plant metabolite (CHEBI:76924) |
| neobavaisoflavone (CHEBI:66614) has role platelet aggregation inhibitor (CHEBI:50427) |
| neobavaisoflavone (CHEBI:66614) is a 7-hydroxyisoflavones (CHEBI:55465) |
| Incoming Relation(s) |
| 2'-hydroxyneobavaisoflavanone (CHEBI:66048) has functional parent neobavaisoflavone (CHEBI:66614) |
| IUPAC Name |
|---|
| 7-hydroxy-3-[4-hydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 7,4'-dihydroxy-3'-(3-methyl-buten-2-yl)isoflavone | ChEBI |
| 7,4'-dihydroxy-3'-(γ,γ-dimethylallyl)isoflavone | ChEBI |
| 7-hydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-4H-1-benzopyran-4-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12050027 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4518386 | Reaxys |
| Citations |
|---|