EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O6 |
| Net Charge | 0 |
| Average Mass | 358.390 |
| Monoisotopic Mass | 358.14164 |
| SMILES | [H][C@]1(c2ccc(O)c(OC)c2)c2cc(O)c(OC)cc2C=C(CO)[C@@H]1CO |
| InChI | InChI=1S/C20H22O6/c1-25-18-6-11(3-4-16(18)23)20-14-8-17(24)19(26-2)7-12(14)5-13(9-21)15(20)10-22/h3-8,15,20-24H,9-10H2,1-2H3/t15-,20-/m0/s1 |
| InChIKey | AKOLXLNVZGAYAV-YWZLYKJASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitex negundo (ncbitaxon:361442) | root (BTO:0001188) | PubMed (15520511) |
| Roles Classification |
|---|
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| negundin B (CHEBI:66613) has role lipoxygenase inhibitor (CHEBI:35856) |
| negundin B (CHEBI:66613) has role plant metabolite (CHEBI:76924) |
| negundin B (CHEBI:66613) is a guaiacols (CHEBI:134251) |
| negundin B (CHEBI:66613) is a lignan (CHEBI:25036) |
| negundin B (CHEBI:66613) is a polyphenol (CHEBI:26195) |
| negundin B (CHEBI:66613) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| (7R,8S)-8-(4-hydroxy-3-methoxyphenyl)-6,7-bis(hydroxymethyl)-3-methoxy-7,8-dihydronaphthalen-2-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18484753 | Reaxys |
| Citations |
|---|