EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30O5 |
| Net Charge | 0 |
| Average Mass | 422.521 |
| Monoisotopic Mass | 422.20932 |
| SMILES | COc1c([C@@H]2COc3c(ccc(O)c3CC=C(C)C)C2=O)ccc(O)c1CC=C(C)C |
| InChI | InChI=1S/C26H30O5/c1-15(2)6-8-18-22(27)12-10-17(25(18)30-5)21-14-31-26-19(9-7-16(3)4)23(28)13-11-20(26)24(21)29/h6-7,10-13,21,27-28H,8-9,14H2,1-5H3/t21-/m0/s1 |
| InChIKey | XCHYGHACCAXWJR-NRFANRHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lespedeza floribunda (ncbitaxon:587870) | root (BTO:0001188) | PubMed (19132934) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lespeflorin D1 (CHEBI:66609) has role melanin synthesis inhibitor (CHEBI:64933) |
| lespeflorin D1 (CHEBI:66609) has role metabolite (CHEBI:25212) |
| lespeflorin D1 (CHEBI:66609) is a hydroxyisoflavanone (CHEBI:72739) |
| lespeflorin D1 (CHEBI:66609) is a methoxyisoflavanone (CHEBI:72740) |
| IUPAC Name |
|---|
| (3R)-7-hydroxy-3-[4-hydroxy-2-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]-8-(3-methylbut-2-en-1-yl)-2,3-dihydro-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19089532 | Reaxys |
| Citations |
|---|