EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | Cc1cc(O)cc(C)c1C[C@@H]1CC(=O)OC1(C)C |
| InChI | InChI=1S/C15H20O3/c1-9-5-12(16)6-10(2)13(9)7-11-8-14(17)18-15(11,3)4/h5-6,11,16H,7-8H2,1-4H3/t11-/m1/s1 |
| InChIKey | JEUPLAJVBQWXMD-LLVKDONJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lyratum (ncbitaxon:230192) | whole plant (BTO:0001461) | PubMed (19336938) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lyratol D (CHEBI:66608) has role antineoplastic agent (CHEBI:35610) |
| lyratol D (CHEBI:66608) has role metabolite (CHEBI:25212) |
| lyratol D (CHEBI:66608) is a butan-4-olide (CHEBI:22950) |
| lyratol D (CHEBI:66608) is a phenols (CHEBI:33853) |
| lyratol D (CHEBI:66608) is a sesquiterpene lactone (CHEBI:37667) |
| Synonym | Source |
|---|---|
| (4R)-4-(4-hydroxy-2,6-dimethylbenzyl)-5,5-dimethyldihydrofuran-2(3H)-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19683899 | Reaxys |
| Citations |
|---|