EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O4 |
| Net Charge | 0 |
| Average Mass | 270.369 |
| Monoisotopic Mass | 270.18311 |
| SMILES | [H][C@]1(C(C)(O)CO)CC[C@]2(C)[C@@H](O)[C@H](O)CC(=C)[C@@]2([H])C1 |
| InChI | InChI=1S/C15H26O4/c1-9-6-12(17)13(18)14(2)5-4-10(7-11(9)14)15(3,19)8-16/h10-13,16-19H,1,4-8H2,2-3H3/t10-,11+,12+,13-,14-,15?/m0/s1 |
| InChIKey | QLYUSONKBWKHRY-MKGDQNAVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lyratum (ncbitaxon:230192) | whole plant (BTO:0001461) | PubMed (19336938) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lyratol C (CHEBI:66607) has role antineoplastic agent (CHEBI:35610) |
| lyratol C (CHEBI:66607) has role metabolite (CHEBI:25212) |
| lyratol C (CHEBI:66607) is a carbobicyclic compound (CHEBI:36785) |
| lyratol C (CHEBI:66607) is a primary alcohol (CHEBI:15734) |
| lyratol C (CHEBI:66607) is a secondary alcohol (CHEBI:35681) |
| lyratol C (CHEBI:66607) is a sesquiterpenoid (CHEBI:26658) |
| lyratol C (CHEBI:66607) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| (1R,2R,4aR,6S,8aS)-6-[(2S)-1,2-dihydroxypropan-2-yl]-8a-methyl-4-methylidenedecahydronaphthalene-1,2-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19683900 | Reaxys |
| Citations |
|---|