EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O7 |
| Net Charge | 0 |
| Average Mass | 392.448 |
| Monoisotopic Mass | 392.18350 |
| SMILES | [H][C@@]12C[C@@H](C)CCC(=O)[C@](C)(OC(C)=O)C[C@H](OC(=O)C(=C)C)[C@@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C21H28O7/c1-11(2)19(24)27-16-10-21(6,28-14(5)22)17(23)8-7-12(3)9-15-18(16)13(4)20(25)26-15/h12,15-16,18H,1,4,7-10H2,2-3,5-6H3/t12-,15+,16-,18-,21+/m0/s1 |
| InChIKey | HBRKQMNFEIZZOU-AGKHZPTMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lychnophora antillana (ncbitaxon:41601) | |||
| leaf (BTO:0000713) | PubMed (2380713) | ||
| stem (BTO:0001300) | PubMed (2380713) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lychnostatin 2 (CHEBI:66602) has role antineoplastic agent (CHEBI:35610) |
| lychnostatin 2 (CHEBI:66602) has role metabolite (CHEBI:25212) |
| lychnostatin 2 (CHEBI:66602) is a acetate ester (CHEBI:47622) |
| lychnostatin 2 (CHEBI:66602) is a cyclic ketone (CHEBI:3992) |
| lychnostatin 2 (CHEBI:66602) is a germacranolide (CHEBI:73011) |
| IUPAC Name |
|---|
| (3aS,4S,6R,10S,11aR)-6-(acetyloxy)-6,10-dimethyl-3-methylidene-2,7-dioxododecahydrocyclodeca[b]furan-4-yl 2-methylprop-2-enoate |
| Registry Numbers | Sources |
|---|---|
| CAS:128700-84-5 | ChemIDplus |
| Citations |
|---|