EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36O14 |
| Net Charge | 0 |
| Average Mass | 584.571 |
| Monoisotopic Mass | 584.21051 |
| SMILES | [H][C@@]1(CC(=O)OCC(OCC)c2ccc(O)c(O)c2)C(C(=O)OC)=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)/C1=C/C |
| InChI | InChI=1S/C27H36O14/c1-4-14-15(9-21(31)38-12-20(37-5-2)13-6-7-17(29)18(30)8-13)16(25(35)36-3)11-39-26(14)41-27-24(34)23(33)22(32)19(10-28)40-27/h4,6-8,11,15,19-20,22-24,26-30,32-34H,5,9-10,12H2,1-3H3/b14-4+/t15-,19+,20?,22+,23-,24+,26-,27-/m0/s1 |
| InChIKey | RDLNVCALMXCDOJ-QUVQPCEGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ligustrum lucidum (ncbitaxon:458695) | fruit (BTO:0000486) | PubMed (11411539) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lucidumoside C (CHEBI:66596) has role antioxidant (CHEBI:22586) |
| lucidumoside C (CHEBI:66596) has role antiviral agent (CHEBI:22587) |
| lucidumoside C (CHEBI:66596) has role plant metabolite (CHEBI:76924) |
| lucidumoside C (CHEBI:66596) is a catechols (CHEBI:33566) |
| lucidumoside C (CHEBI:66596) is a methyl ester (CHEBI:25248) |
| lucidumoside C (CHEBI:66596) is a monosaccharide derivative (CHEBI:63367) |
| lucidumoside C (CHEBI:66596) is a monoterpene glycoside (CHEBI:72293) |
| lucidumoside C (CHEBI:66596) is a pyrans (CHEBI:26407) |
| lucidumoside C (CHEBI:66596) is a secoiridoid glycoside (CHEBI:50274) |
| lucidumoside C (CHEBI:66596) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| methyl (2S,3E,4S)-4-{2-[2-(3,4-dihydroxyphenyl)-2-ethoxyethoxy]-2-oxoethyl}-3-ethylidene-2-(β-D-glucopyranosyloxy)-3,4-dihydro-2H-pyran-5-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9105607 | Reaxys |
| Citations |
|---|