EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O6 |
| Net Charge | 0 |
| Average Mass | 460.611 |
| Monoisotopic Mass | 460.28249 |
| SMILES | [H][C@@]12C[C@H](O)C3=C(C(=O)C[C@@]4(C)[C@@]3(C)C(=O)C[C@]4([H])[C@H](C)CCC(=O)O)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C27H40O6/c1-14(7-8-21(32)33)15-11-20(31)27(6)23-16(28)12-18-24(2,3)19(30)9-10-25(18,4)22(23)17(29)13-26(15,27)5/h14-16,18-19,28,30H,7-13H2,1-6H3,(H,32,33)/t14-,15-,16+,18+,19+,25+,26-,27+/m1/s1 |
| InChIKey | YBGBNHHXOJXFNM-UQCMLMITSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | fruit body (BTO:0000487) | PubMed (11520245) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lucidenic acid N (CHEBI:66595) has role antineoplastic agent (CHEBI:35610) |
| lucidenic acid N (CHEBI:66595) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| lucidenic acid N (CHEBI:66595) has role metabolite (CHEBI:25212) |
| lucidenic acid N (CHEBI:66595) is a cyclic terpene ketone (CHEBI:36130) |
| lucidenic acid N (CHEBI:66595) is a dioxo monocarboxylic acid (CHEBI:35951) |
| lucidenic acid N (CHEBI:66595) is a secondary alcohol (CHEBI:35681) |
| lucidenic acid N (CHEBI:66595) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3β,5α,7β)-3,7-dihydroxy-4,4,14-trimethyl-11,15-dioxochol-8-en-24-oic acid |
| Synonym | Source |
|---|---|
| 3,7-Dihydroxy-25,26,27-trinor-11,15-dioxolanost-8-en-24-oic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 10213993 | ChemSpider |
| HMDB0038352 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8956644 | Reaxys |
| Citations |
|---|