EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O3 |
| Net Charge | 0 |
| Average Mass | 452.679 |
| Monoisotopic Mass | 452.32905 |
| SMILES | [H][C@@]12CC(=O)C3=C(CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)CC/C=C(\C)C=O)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C30H44O3/c1-19(18-31)9-8-10-20(2)21-11-16-30(7)26-22(12-15-29(21,30)6)28(5)14-13-25(33)27(3,4)24(28)17-23(26)32/h9,18,20-21,24H,8,10-17H2,1-7H3/b19-9+/t20-,21-,24+,28-,29-,30+/m1/s1 |
| InChIKey | KZOBOICRKKYGAQ-GOUGDUPLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma pfeifferi (ncbitaxon:34464) | - | PubMed (16378363) | |
| Ganoderma lucidum (ncbitaxon:5315) | - | PubMed (12045343) |
| Roles Classification |
|---|
| Biological Roles: | anti-HSV agent An antiviral agent that destroys or inhibits the replication of the herpes simplex virus (also known as the human herpes virus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lucialdehyde B (CHEBI:66593) has parent hydride lanostane (CHEBI:20265) |
| lucialdehyde B (CHEBI:66593) has role anti-HSV agent (CHEBI:64952) |
| lucialdehyde B (CHEBI:66593) has role antineoplastic agent (CHEBI:35610) |
| lucialdehyde B (CHEBI:66593) has role metabolite (CHEBI:25212) |
| lucialdehyde B (CHEBI:66593) is a 3-oxo-5α-steroid (CHEBI:13601) |
| lucialdehyde B (CHEBI:66593) is a 7-oxo steroid (CHEBI:47789) |
| lucialdehyde B (CHEBI:66593) is a cyclic terpene ketone (CHEBI:36130) |
| lucialdehyde B (CHEBI:66593) is a steroid aldehyde (CHEBI:131565) |
| lucialdehyde B (CHEBI:66593) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (24E)-3,7-dioxolanosta-8,24-dien-26-al |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9238781 | Reaxys |
| Citations |
|---|