EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O3 |
| Net Charge | 0 |
| Average Mass | 452.679 |
| Monoisotopic Mass | 452.32905 |
| SMILES | [H][C@@]12CC(=O)C3=C(CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)CC/C=C(\C)C=O)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C30H44O3/c1-19(18-31)9-8-10-20(2)21-11-16-30(7)26-22(12-15-29(21,30)6)28(5)14-13-25(33)27(3,4)24(28)17-23(26)32/h9,18,20-21,24H,8,10-17H2,1-7H3/b19-9+/t20-,21-,24+,28-,29-,30+/m1/s1 |
| InChIKey | KZOBOICRKKYGAQ-GOUGDUPLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | - | PubMed (12045343) | |
| Ganoderma pfeifferi (ncbitaxon:34464) | - | PubMed (16378363) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HSV agent An antiviral agent that destroys or inhibits the replication of the herpes simplex virus (also known as the human herpes virus). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lucialdehyde B (CHEBI:66593) has parent hydride lanostane (CHEBI:20265) |
| lucialdehyde B (CHEBI:66593) has role anti-HSV agent (CHEBI:64952) |
| lucialdehyde B (CHEBI:66593) has role antineoplastic agent (CHEBI:35610) |
| lucialdehyde B (CHEBI:66593) has role metabolite (CHEBI:25212) |
| lucialdehyde B (CHEBI:66593) is a 3-oxo-5α-steroid (CHEBI:13601) |
| lucialdehyde B (CHEBI:66593) is a 7-oxo steroid (CHEBI:47789) |
| lucialdehyde B (CHEBI:66593) is a cyclic terpene ketone (CHEBI:36130) |
| lucialdehyde B (CHEBI:66593) is a steroid aldehyde (CHEBI:131565) |
| lucialdehyde B (CHEBI:66593) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (24E)-3,7-dioxolanosta-8,24-dien-26-al |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9238781 | Reaxys |
| Citations |
|---|