EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H41NO12S |
| Net Charge | 0 |
| Average Mass | 687.764 |
| Monoisotopic Mass | 687.23495 |
| SMILES | [H][C@]12C[C@@H](OC(C)=O)[C@H](C)[C@@H](O)[C@]1([H])C=C[C@@]1([H])C[C@@H](/C=C/C=C/C=C/C(=O)O)[C@@]3(C(=O)O[C@H](CSC[C@@H](NC(C)=O)C(=O)O)C3=O)C(=O)[C@]21C |
| InChI | InChI=1S/C34H41NO12S/c1-17-25(46-19(3)37)14-23-22(28(17)40)12-11-20-13-21(9-7-5-6-8-10-27(38)39)34(31(44)33(20,23)4)29(41)26(47-32(34)45)16-48-15-24(30(42)43)35-18(2)36/h5-12,17,20-26,28,40H,13-16H2,1-4H3,(H,35,36)(H,38,39)(H,42,43)/b6-5+,9-7+,10-8+/t17-,20-,21+,22+,23-,24+,25+,26+,28+,33-,34-/m0/s1 |
| InChIKey | PTLQDKFYOYMVQN-CECFYEBASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lucensis (ncbitaxon:67319) | - | PubMed (19115838) | Strain: MA7349 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lucensimycin E (CHEBI:66592) has role antibacterial agent (CHEBI:33282) |
| lucensimycin E (CHEBI:66592) has role antimicrobial agent (CHEBI:33281) |
| lucensimycin E (CHEBI:66592) has role bacterial metabolite (CHEBI:76969) |
| lucensimycin E (CHEBI:66592) is a acetamides (CHEBI:22160) |
| lucensimycin E (CHEBI:66592) is a acetate ester (CHEBI:47622) |
| lucensimycin E (CHEBI:66592) is a dicarboxylic acid (CHEBI:35692) |
| lucensimycin E (CHEBI:66592) is a ketolactone (CHEBI:50361) |
| lucensimycin E (CHEBI:66592) is a organic heterotetracyclic compound (CHEBI:38163) |
| lucensimycin E (CHEBI:66592) is a organic sulfide (CHEBI:16385) |
| lucensimycin E (CHEBI:66592) is a oxaspiro compound (CHEBI:37948) |
| IUPAC Name |
|---|
| (2E,4E,6E)-7-[(2'S,3R,4a'S,4b'S,5S,6'R,7'R,8'S,8a'R,10a'R)-5-({[(2S)-2-(acetylamino)-2-carboxyethyl]sulfanyl}methyl)-6'-(acetyloxy)-8'-hydroxy-4a',7'-dimethyl-2,4,4'-trioxo-1',4,4',4a',4b',5,5',6',7',8',8a',10a'-dodecahydro-2'H-spiro[furan-3,3'-phenanthren]-2'-yl]hepta-2,4,6-trienoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19619266 | Reaxys |
| Citations |
|---|