EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H32O8 |
| Net Charge | 0 |
| Average Mass | 532.589 |
| Monoisotopic Mass | 532.20972 |
| SMILES | COc1cc2c(c(O)c1OC)-c1c(cc3c(c1OC)OCO3)[C@H](OC(=O)/C=C/c1ccccc1)[C@H](C)[C@H](C)C2 |
| InChI | InChI=1S/C31H32O8/c1-17-13-20-14-22(34-3)29(35-4)27(33)25(20)26-21(15-23-30(31(26)36-5)38-16-37-23)28(18(17)2)39-24(32)12-11-19-9-7-6-8-10-19/h6-12,14-15,17-18,28,33H,13,16H2,1-5H3/b12-11+/t17-,18-,28-/m1/s1 |
| InChIKey | MWCNCFCBBXKOCI-CMTGZUNTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura longipedunculata (ncbitaxon:124782) | |||
| stem (BTO:0001300) | PubMed (16394567) | ||
| root (BTO:0001188) | PubMed (16394567) |
| Roles Classification |
|---|
| Biological Roles: | HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| longipedumin A (CHEBI:66591) has role HIV protease inhibitor (CHEBI:35660) |
| longipedumin A (CHEBI:66591) has role metabolite (CHEBI:25212) |
| longipedumin A (CHEBI:66591) is a aromatic ether (CHEBI:35618) |
| longipedumin A (CHEBI:66591) is a cinnamate ester (CHEBI:36087) |
| longipedumin A (CHEBI:66591) is a lignan (CHEBI:25036) |
| longipedumin A (CHEBI:66591) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| (6R,7R,8R)-1-hydroxy-2,3,13-trimethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-8-yl (2E)-3-phenylprop-2-enoate |
| Citations |
|---|