EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H37N5O6 |
| Net Charge | 0 |
| Average Mass | 611.699 |
| Monoisotopic Mass | 611.27438 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC2=O |
| InChI | InChI=1S/C34H37N5O6/c40-25-15-13-24(14-16-25)20-28-34(45)39-17-7-12-29(39)33(44)37-26(18-22-8-3-1-4-9-22)31(42)35-21-30(41)36-27(32(43)38-28)19-23-10-5-2-6-11-23/h1-6,8-11,13-16,26-29,40H,7,12,17-21H2,(H,35,42)(H,36,41)(H,37,44)(H,38,43)/t26-,27-,28-,29-/m0/s1 |
| InChIKey | CWNYOXLYNGDTSL-DZUOILHNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dianthus superbus var. longicalycinus (ncbitaxon:713924) | whole plant (BTO:0001461) | PubMed (15744111) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| longicalycinin A (CHEBI:66590) has role antineoplastic agent (CHEBI:35610) |
| longicalycinin A (CHEBI:66590) has role metabolite (CHEBI:25212) |
| longicalycinin A (CHEBI:66590) is a homodetic cyclic peptide (CHEBI:24613) |
| longicalycinin A (CHEBI:66590) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| cyclo(glycyl-L-phenylalanyl-L-tyrosyl-L-prolyl-L-phenylalanyl) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10138036 | Reaxys |
| Citations |
|---|