EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38O18 |
| Net Charge | 0 |
| Average Mass | 674.605 |
| Monoisotopic Mass | 674.20581 |
| SMILES | COc1cc(CO[C@@H]2O[C@H](CO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](OC(=O)c3cc(O)c(O)c(O)c3)[C@H]2O)cc(OC)c1OC |
| InChI | InChI=1S/C29H38O18/c1-40-15-4-11(5-16(41-2)25(15)42-3)9-43-29-24(38)26(47-27(39)12-6-13(31)19(33)14(32)7-12)21(35)18(46-29)10-44-28-23(37)22(36)20(34)17(8-30)45-28/h4-7,17-18,20-24,26,28-38H,8-10H2,1-3H3/t17-,18-,20-,21-,22+,23-,24-,26+,28-,29-/m1/s1 |
| InChIKey | MJPDNEFPKGWFBA-AWMQXIHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Symplocos racemosa (IPNI:827267-1) | stem (BTO:0001300) | DOI (10.1016/j.phytol.2008.02.001) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.21.1 (chymotrypsin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of chymotrypsin (EC 3.4.21.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| locoracemoside C (CHEBI:66589) has role EC 3.4.21.1 (chymotrypsin) inhibitor (CHEBI:64943) |
| locoracemoside C (CHEBI:66589) has role metabolite (CHEBI:25212) |
| locoracemoside C (CHEBI:66589) is a O-acyl carbohydrate (CHEBI:52782) |
| locoracemoside C (CHEBI:66589) is a disaccharide derivative (CHEBI:63353) |
| locoracemoside C (CHEBI:66589) is a gallate ester (CHEBI:37576) |
| locoracemoside C (CHEBI:66589) is a methoxybenzenes (CHEBI:51683) |
| IUPAC Name |
|---|
| 3,4,5-trimethoxybenzyl 6-O-β-D-glucopyranosyl-3-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 3'-O-galloyl-6'-O-β-D-glucopyranosyl-1'-O-(3,4,5-trimethoxybenzyl)-β-D-glucopyranoside | ChEBI |