EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32O14 |
| Net Charge | 0 |
| Average Mass | 580.539 |
| Monoisotopic Mass | 580.17921 |
| SMILES | COc1ccc(CO[C@@H]2O[C@H](CO[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](OC(=O)c3ccccc3)[C@H]2O)cc1 |
| InChI | InChI=1S/C27H32O14/c1-36-15-9-7-13(8-10-15)11-37-27-21(32)22(40-25(35)14-5-3-2-4-6-14)17(28)16(39-27)12-38-26-20(31)18(29)19(30)23(41-26)24(33)34/h2-10,16-23,26-32H,11-12H2,1H3,(H,33,34)/t16-,17-,18+,19+,20-,21-,22+,23+,26-,27-/m1/s1 |
| InChIKey | VHIOJRIABYFBNA-LRYVTLDSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Symplocos racemosa (IPNI:827267-1) | stem (BTO:0001300) | DOI (10.1016/j.phytol.2008.02.001) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.21.1 (chymotrypsin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of chymotrypsin (EC 3.4.21.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| locoracemoside B (CHEBI:66588) has role EC 3.4.21.1 (chymotrypsin) inhibitor (CHEBI:64943) |
| locoracemoside B (CHEBI:66588) has role metabolite (CHEBI:25212) |
| locoracemoside B (CHEBI:66588) is a O-acyl carbohydrate (CHEBI:52782) |
| locoracemoside B (CHEBI:66588) is a benzoate ester (CHEBI:36054) |
| locoracemoside B (CHEBI:66588) is a disaccharide derivative (CHEBI:63353) |
| locoracemoside B (CHEBI:66588) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| 4-methoxybenzyl 3-O-benzoyl-6-O-β-D-glucopyranuronosyl-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 3'-O-benzoyl-6'-O-β-glucuronopyranosyl- 1'-O-p-methoxybenzyl-β-D-glucopyranoside | ChEBI |