EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H33NO4 |
| Net Charge | 0 |
| Average Mass | 375.509 |
| Monoisotopic Mass | 375.24096 |
| SMILES | [H][C@@]12CC/C(C)=C/CC/C(C(=O)O)=C/CC/C(C)=C/[C@]1([H])OC(=O)[C@H]2CN(C)C |
| InChI | InChI=1S/C22H33NO4/c1-15-7-5-9-17(21(24)25)10-6-8-16(2)13-20-18(12-11-15)19(14-23(3)4)22(26)27-20/h7,10,13,18-20H,5-6,8-9,11-12,14H2,1-4H3,(H,24,25)/b15-7+,16-13+,17-10-/t18-,19-,20-/m0/s1 |
| InChIKey | HRPBIJBOFQXOTL-JEJSWHNFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lobophytum (ncbitaxon:205095) | - | PubMed (10785433) | Aqueous extract |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-dimethylaminolobohedleolide (CHEBI:66587) has role anti-HIV-1 agent (CHEBI:64947) |
| 17-dimethylaminolobohedleolide (CHEBI:66587) has role coral metabolite (CHEBI:76498) |
| 17-dimethylaminolobohedleolide (CHEBI:66587) is a cembrane diterpenoid (CHEBI:60687) |
| 17-dimethylaminolobohedleolide (CHEBI:66587) is a monocarboxylic acid (CHEBI:25384) |
| 17-dimethylaminolobohedleolide (CHEBI:66587) is a tertiary amine (CHEBI:32876) |
| 17-dimethylaminolobohedleolide (CHEBI:66587) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3R,3aS,6E,10E,14E,15aR)-3-[(dimethylamino)methyl]-6,14-dimethyl-2-oxo-2,3,3a,4,5,8,9,12,13,15a-decahydrocyclotetradeca[b]furan-10-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8589733 | Reaxys |
| Citations |
|---|