EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O4 |
| Net Charge | 0 |
| Average Mass | 330.424 |
| Monoisotopic Mass | 330.18311 |
| SMILES | [H][C@@]12CC/C(C)=C/CC/C(C(=O)O)=C/CC/C(C)=C/[C@]1([H])OC(=O)C2=C |
| InChI | InChI=1S/C20H26O4/c1-13-6-4-8-16(19(21)22)9-5-7-14(2)12-18-17(11-10-13)15(3)20(23)24-18/h6,9,12,17-18H,3-5,7-8,10-11H2,1-2H3,(H,21,22)/b13-6+,14-12+,16-9-/t17-,18-/m0/s1 |
| InChIKey | SORYERHBQFTRIK-JMQTVVQQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lobophytum (ncbitaxon:205095) | - | PubMed (10785433) | Aqueous extract |
| Lobophytum hedleyi (WORMS:292556) | - | DOI (10.1016/S0040-4039(01)82073-6) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7Z)-lobohedleolide (CHEBI:66586) has role anti-HIV-1 agent (CHEBI:64947) |
| (7Z)-lobohedleolide (CHEBI:66586) has role coral metabolite (CHEBI:76498) |
| (7Z)-lobohedleolide (CHEBI:66586) is a cembrane diterpenoid (CHEBI:60687) |
| (7Z)-lobohedleolide (CHEBI:66586) is a monocarboxylic acid (CHEBI:25384) |
| (7Z)-lobohedleolide (CHEBI:66586) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aS,6E,10Z,14E,15aS)-6,14-dimethyl-3-methylidene-2-oxo-2,3,3a,4,5,8,9,12,13,15a-decahydrocyclotetradeca[b]furan-10-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4709575 | Reaxys |
| Citations |
|---|