EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:66583 - littorachalcone
| Formula | C30H26O8 |
| Net Charge | 0 |
| Average Mass | 514.530 |
| Monoisotopic Mass | 514.16277 |
| SMILES | O=C(CCc1ccc(Oc2ccc(CCC(=O)c3ccc(O)cc3O)cc2O)cc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C30H26O8/c31-20-6-10-23(27(35)16-20)25(33)12-3-18-1-8-22(9-2-18)38-30-14-5-19(15-29(30)37)4-13-26(34)24-11-7-21(32)17-28(24)36/h1-2,5-11,14-17,31-32,35-37H,3-4,12-13H2 |
| InChIKey | OCIOEDQDLZEZRK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Verbena litoralis (ncbitaxon:443384) | aerial part (BTO:0001658) | PubMed (12843601) |
| Roles Classification |
|---|
| Biological Roles: | nerve growth factor stimulator Any molecule shown to have the potentiality in stimulating the effect of nerve growth factor. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | nerve growth factor stimulator Any molecule shown to have the potentiality in stimulating the effect of nerve growth factor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| littorachalcone (CHEBI:66583) has role metabolite (CHEBI:25212) |
| littorachalcone (CHEBI:66583) has role nerve growth factor stimulator (CHEBI:72294) |
| littorachalcone (CHEBI:66583) is a aromatic ether (CHEBI:35618) |
| littorachalcone (CHEBI:66583) is a dihydrochalcones (CHEBI:71230) |
| littorachalcone (CHEBI:66583) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 1-(2,4-dihydroxyphenyl)-3-(4-{4-[3-(2,4-dihydroxyphenyl)-3-oxopropyl]-2-hydroxyphenoxy}phenyl)propan-1-one |
| Synonym | Source |
|---|---|
| 2',4',3'',2''',4'''-pentahydroxy-4-O-4'''-tetrahydrobichalcone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9532163 | Reaxys |
| Citations |
|---|