EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38N2O4S4 |
| Net Charge | 0 |
| Average Mass | 570.868 |
| Monoisotopic Mass | 570.17144 |
| SMILES | COc1c(OC)c2c(c(CCN(C)C)c1SC)Sc1c(OC)c(OC)c(SC)c(CCN(C)C)c1S2 |
| InChI | InChI=1S/C26H38N2O4S4/c1-27(2)13-11-15-21(33-9)17(29-5)19(31-7)25-23(15)35-26-20(32-8)18(30-6)22(34-10)16(24(26)36-25)12-14-28(3)4/h11-14H2,1-10H3 |
| InChIKey | DDNBLGHDDGIIFX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lissoclinum badium (ncbitaxon:322848) | - | PubMed (17268087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lissoclibadin 3 (CHEBI:66581) has role animal metabolite (CHEBI:75767) |
| lissoclibadin 3 (CHEBI:66581) has role antineoplastic agent (CHEBI:35610) |
| lissoclibadin 3 (CHEBI:66581) has role marine metabolite (CHEBI:76507) |
| lissoclibadin 3 (CHEBI:66581) is a aromatic ether (CHEBI:35618) |
| lissoclibadin 3 (CHEBI:66581) is a aryl sulfide (CHEBI:35683) |
| lissoclibadin 3 (CHEBI:66581) is a tertiary amino compound (CHEBI:50996) |
| lissoclibadin 3 (CHEBI:66581) is a thianthrenes (CHEBI:64513) |
| IUPAC Name |
|---|
| 2,2'-[3,4,8,9-tetramethoxy-2,7-bis(methylsulfanyl)thianthrene-1,6-diyl]bis(N,N-dimethylethanamine) |
| Synonyms | Source |
|---|---|
| 3,4,8,9-tetramethoxy-N1,N1,N6,N6-tetramethyl-2,7-bis(methylthio)-1,6-thianthrenediethanamine | ChEBI |
| Lissoclinotoxin E | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9528972 | Reaxys |
| Citations |
|---|