EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H57N3O6S7 |
| Net Charge | 0 |
| Average Mass | 888.369 |
| Monoisotopic Mass | 887.22923 |
| SMILES | COc1c(SC)c(CCN(C)C)c2ssc3c(CCN(C)C)c(SC)c(OC)c(OC)c3sc3c(OC)c(OC)c(SC)c(CCN(C)C)c3sc2c1OC |
| InChI | InChI=1S/C39H57N3O6S7/c1-40(2)19-16-22-31(49-13)25(43-7)28(46-10)37-34(22)52-38-29(47-11)26(44-8)32(50-14)23(17-20-41(3)4)35(38)54-55-36-24(18-21-42(5)6)33(51-15)27(45-9)30(48-12)39(36)53-37/h16-21H2,1-15H3 |
| InChIKey | SYYGQWWWVKVZAF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lissoclinum badium (ncbitaxon:322848) | - | PubMed (17268087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lissoclibadin 1 (CHEBI:66579) has role animal metabolite (CHEBI:75767) |
| lissoclibadin 1 (CHEBI:66579) has role antineoplastic agent (CHEBI:35610) |
| lissoclibadin 1 (CHEBI:66579) has role marine metabolite (CHEBI:76507) |
| lissoclibadin 1 (CHEBI:66579) is a aromatic ether (CHEBI:35618) |
| lissoclibadin 1 (CHEBI:66579) is a aryl sulfide (CHEBI:35683) |
| lissoclibadin 1 (CHEBI:66579) is a organic heterotetracyclic compound (CHEBI:38163) |
| lissoclibadin 1 (CHEBI:66579) is a organosulfur heterocyclic compound (CHEBI:38106) |
| lissoclibadin 1 (CHEBI:66579) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2,2',2''-[1,2,9,10,14,15-hexamethoxy-3,8,13-tris(methylsulfanyl)tribenzo[c,f,i][1,2,5,8]tetrathiecine-4,7,12-triyl]tris(N,N-dimethylethanamine) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9892027 | Reaxys |
| Citations |
|---|