EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O4 |
| Net Charge | 0 |
| Average Mass | 356.462 |
| Monoisotopic Mass | 356.19876 |
| SMILES | [H][C@@]12CC[C@@H](C)c3oc4c(C=O)c(O)c(O)cc4c3[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C22H28O4/c1-12-6-7-16-21(2,3)8-5-9-22(16,4)17-13-10-15(24)18(25)14(11-23)20(13)26-19(12)17/h10-12,16,24-25H,5-9H2,1-4H3/t12-,16+,22+/m1/s1 |
| InChIKey | NVDJGYXDFMEUPO-KGFDFFDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aka coralliphaga (ncbitaxon:178516) | - | PubMed (16408905) |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| liphagal (CHEBI:66578) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| liphagal (CHEBI:66578) has role metabolite (CHEBI:25212) |
| liphagal (CHEBI:66578) is a aldehyde (CHEBI:17478) |
| liphagal (CHEBI:66578) is a cyclic ether (CHEBI:37407) |
| liphagal (CHEBI:66578) is a meroterpenoid (CHEBI:64419) |
| liphagal (CHEBI:66578) is a organic heterotetracyclic compound (CHEBI:38163) |
| liphagal (CHEBI:66578) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (4aS,7R,12cS)-10,11-dihydroxy-4,4,7,12c-tetramethyl-2,3,4,4a,5,6,7,12c-octahydro-1H-benzo[b]benzo[6,7]cyclohepta[1,2-d]furan-9-carbaldehyde |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10300564 | Reaxys |
| Citations |
|---|