EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O4 |
| Net Charge | 0 |
| Average Mass | 356.462 |
| Monoisotopic Mass | 356.19876 |
| SMILES | [H][C@@]12CC[C@@H](C)c3oc4c(C=O)c(O)c(O)cc4c3[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C22H28O4/c1-12-6-7-16-21(2,3)8-5-9-22(16,4)17-13-10-15(24)18(25)14(11-23)20(13)26-19(12)17/h10-12,16,24-25H,5-9H2,1-4H3/t12-,16+,22+/m1/s1 |
| InChIKey | NVDJGYXDFMEUPO-KGFDFFDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aka coralliphaga (ncbitaxon:178516) | - | PubMed (16408905) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| liphagal (CHEBI:66578) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| liphagal (CHEBI:66578) has role metabolite (CHEBI:25212) |
| liphagal (CHEBI:66578) is a aldehyde (CHEBI:17478) |
| liphagal (CHEBI:66578) is a cyclic ether (CHEBI:37407) |
| liphagal (CHEBI:66578) is a meroterpenoid (CHEBI:64419) |
| liphagal (CHEBI:66578) is a organic heterotetracyclic compound (CHEBI:38163) |
| liphagal (CHEBI:66578) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (4aS,7R,12cS)-10,11-dihydroxy-4,4,7,12c-tetramethyl-2,3,4,4a,5,6,7,12c-octahydro-1H-benzo[b]benzo[6,7]cyclohepta[1,2-d]furan-9-carbaldehyde |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10300564 | Reaxys |
| Citations |
|---|