EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H28O12 |
| Net Charge | 0 |
| Average Mass | 580.542 |
| Monoisotopic Mass | 580.15808 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)OC[C@H]1O[C@@H](Oc2ccc([C@@H]3CC(=O)c4cc(O)cc(O)c4O3)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H28O12/c31-17-6-1-15(2-7-17)3-10-25(35)39-14-24-26(36)27(37)28(38)30(42-24)40-19-8-4-16(5-9-19)23-13-21(33)20-11-18(32)12-22(34)29(20)41-23/h1-12,23-24,26-28,30-32,34,36-38H,13-14H2/b10-3+/t23-,24+,26+,27-,28+,30+/m0/s1 |
| InChIKey | QVEGPDNSRBIZKA-QXAKUUBASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leucas urticifolia (ncbitaxon:483843) | whole plant (BTO:0001461) | PubMed (17909500) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leufolin B (CHEBI:66576) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| leufolin B (CHEBI:66576) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| leufolin B (CHEBI:66576) has role metabolite (CHEBI:25212) |
| leufolin B (CHEBI:66576) is a cinnamate ester (CHEBI:36087) |
| leufolin B (CHEBI:66576) is a dihydroxyflavanone (CHEBI:38749) |
| leufolin B (CHEBI:66576) is a flavanone glycoside (CHEBI:72730) |
| leufolin B (CHEBI:66576) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-[(2S)-6,8-dihydroxy-4-oxo-3,4-dihydro-2H-chromen-2-yl]phenyl 6-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| {6-[4-(6,8-dihydroxy-4-oxo-4H-chromen-2-yl)phenoxy]-3,5-dihydroxytetrahydro-2Hpyran-2-yl}methyl-(E)-3(4-hydroxyphenyl)-2-propenoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11126780 | Reaxys |
| Citations |
|---|