EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36O6 |
| Net Charge | 0 |
| Average Mass | 432.557 |
| Monoisotopic Mass | 432.25119 |
| SMILES | [H][C@]12[C@H](C)CC[C@]1([H])[C@@H](C)[C@@]1(O)OC(C)(C)C=C1[C@]2(O)C(=O)[C@@H](C)CC[C@H]1OC(=O)C=C1C |
| InChI | InChI=1S/C25H36O6/c1-13-7-9-17-16(4)25(29)19(12-23(5,6)31-25)24(28,21(13)17)22(27)14(2)8-10-18-15(3)11-20(26)30-18/h11-14,16-18,21,28-29H,7-10H2,1-6H3/t13-,14+,16-,17-,18-,21+,24-,25-/m1/s1 |
| InChIKey | CZSWARCYWCYVPW-SHWZWCJUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leucosceptrum canum (ncbitaxon:694369) | aerial part (BTO:0001658) | PubMed (15524427) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). |
| Application: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leucosesterlactone (CHEBI:66573) has role angiogenesis inhibitor (CHEBI:48422) |
| leucosesterlactone (CHEBI:66573) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| leucosesterlactone (CHEBI:66573) has role metabolite (CHEBI:25212) |
| leucosesterlactone (CHEBI:66573) is a butenolide (CHEBI:50523) |
| leucosesterlactone (CHEBI:66573) is a organic heterotricyclic compound (CHEBI:26979) |
| leucosesterlactone (CHEBI:66573) is a sesterterpenoid (CHEBI:26660) |
| leucosesterlactone (CHEBI:66573) is a terpene ketone (CHEBI:26872) |
| leucosesterlactone (CHEBI:66573) is a terpene lactone (CHEBI:37668) |
| leucosesterlactone (CHEBI:66573) is a tertiary alcohol (CHEBI:26878) |
| leucosesterlactone (CHEBI:66573) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (5R)-5-{(3S)-4-[(4S,4aS,5R,7aS,8R,8aR)-4,8a-dihydroxy-2,2,5,8-tetramethyl-4,4a,5,6,7,7a,8,8a-octahydro-2H-indeno[5,6-b]furan-4-yl]-3-methyl-4-oxobutyl}-4-methylfuran-2(5H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9963710 | Reaxys |
| Citations |
|---|