EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36O7 |
| Net Charge | 0 |
| Average Mass | 448.556 |
| Monoisotopic Mass | 448.24610 |
| SMILES | [H][C@]12[C@H](C)CC[C@]1([H])[C@@H](C)[C@@]1(O)OCC(C)=C[C@@]1(O)[C@]2(O)C(=O)[C@@H](C)C[C@@H]1C(=O)C(C)=C[C@H]1O |
| InChI | InChI=1S/C25H36O7/c1-12-10-23(29)24(30,22(28)15(4)8-18-19(26)9-14(3)21(18)27)20-13(2)6-7-17(20)16(5)25(23,31)32-11-12/h9-10,13,15-20,26,29-31H,6-8,11H2,1-5H3/t13-,15+,16-,17-,18+,19-,20+,23-,24-,25-/m1/s1 |
| InChIKey | WREVESBXGFRQJD-PHRJMFLCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leucosceptrum canum (ncbitaxon:694369) | aerial part (BTO:0001658) | PubMed (15524427) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). |
| Application: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leucosesterterpenone (CHEBI:66572) has role angiogenesis inhibitor (CHEBI:48422) |
| leucosesterterpenone (CHEBI:66572) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| leucosesterterpenone (CHEBI:66572) has role metabolite (CHEBI:25212) |
| leucosesterterpenone (CHEBI:66572) is a organic heterotricyclic compound (CHEBI:26979) |
| leucosesterterpenone (CHEBI:66572) is a secondary alcohol (CHEBI:35681) |
| leucosesterterpenone (CHEBI:66572) is a sesterterpenoid (CHEBI:26660) |
| leucosesterterpenone (CHEBI:66572) is a terpene ketone (CHEBI:26872) |
| leucosesterterpenone (CHEBI:66572) is a tertiary alcohol (CHEBI:26878) |
| leucosesterterpenone (CHEBI:66572) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (4R,5S)-4-hydroxy-2-methyl-5-{(2S)-2-methyl-3-oxo-3-[(4aR,5S,5aS,6R,8aS,9R,9aR)-4a,5,9a-trihydroxy-3,6,9-trimethyl-2,4a,5,5a,6,7,8,8a,9,9a-decahydrocyclopenta[g]chromen-5-yl]propyl}cyclopent-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9970763 | Reaxys |
| Citations |
|---|