EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36O7 |
| Net Charge | 0 |
| Average Mass | 448.556 |
| Monoisotopic Mass | 448.24610 |
| SMILES | [H][C@]12[C@H](C)CC[C@]1([H])[C@@H](C)[C@@]1(O)OCC(C)=C[C@@]1(O)[C@]2(O)C(=O)[C@@H](C)C[C@@H]1C(=O)C(C)=C[C@H]1O |
| InChI | InChI=1S/C25H36O7/c1-12-10-23(29)24(30,22(28)15(4)8-18-19(26)9-14(3)21(18)27)20-13(2)6-7-17(20)16(5)25(23,31)32-11-12/h9-10,13,15-20,26,29-31H,6-8,11H2,1-5H3/t13-,15+,16-,17-,18+,19-,20+,23-,24-,25-/m1/s1 |
| InChIKey | WREVESBXGFRQJD-PHRJMFLCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leucosceptrum canum (ncbitaxon:694369) | aerial part (BTO:0001658) | PubMed (15524427) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leucosesterterpenone (CHEBI:66572) has role angiogenesis inhibitor (CHEBI:48422) |
| leucosesterterpenone (CHEBI:66572) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| leucosesterterpenone (CHEBI:66572) has role metabolite (CHEBI:25212) |
| leucosesterterpenone (CHEBI:66572) is a organic heterotricyclic compound (CHEBI:26979) |
| leucosesterterpenone (CHEBI:66572) is a secondary alcohol (CHEBI:35681) |
| leucosesterterpenone (CHEBI:66572) is a sesterterpenoid (CHEBI:26660) |
| leucosesterterpenone (CHEBI:66572) is a terpene ketone (CHEBI:26872) |
| leucosesterterpenone (CHEBI:66572) is a tertiary alcohol (CHEBI:26878) |
| leucosesterterpenone (CHEBI:66572) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (4R,5S)-4-hydroxy-2-methyl-5-{(2S)-2-methyl-3-oxo-3-[(4aR,5S,5aS,6R,8aS,9R,9aR)-4a,5,9a-trihydroxy-3,6,9-trimethyl-2,4a,5,5a,6,7,8,8a,9,9a-decahydrocyclopenta[g]chromen-5-yl]propyl}cyclopent-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9970763 | Reaxys |
| Citations |
|---|