EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O2 |
| Net Charge | 0 |
| Average Mass | 428.701 |
| Monoisotopic Mass | 428.36543 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@@](C)(O)/C=C/[C@@H](CC)C(C)C |
| InChI | InChI=1S/C29H48O2/c1-7-20(19(2)3)12-17-29(6,31)26-11-10-24-23-9-8-21-18-22(30)13-15-27(21,4)25(23)14-16-28(24,26)5/h8,12,17,19-20,22-26,30-31H,7,9-11,13-16,18H2,1-6H3/b17-12+/t20-,22+,23+,24+,25+,26+,27+,28+,29+/m1/s1 |
| InChIKey | RFCDBEXZIQZKRG-WSCQTVFPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leucas urticifolia (ncbitaxon:483843) | whole plant (BTO:0001461) | PubMed (18787788) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leucisterol (CHEBI:66571) has parent hydride stigmastane (CHEBI:26773) |
| leucisterol (CHEBI:66571) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| leucisterol (CHEBI:66571) has role metabolite (CHEBI:25212) |
| leucisterol (CHEBI:66571) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| leucisterol (CHEBI:66571) is a 3β-sterol (CHEBI:35348) |
| leucisterol (CHEBI:66571) is a phytosterols (CHEBI:26125) |
| leucisterol (CHEBI:66571) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3β,22E)-stigmasta-5,22-diene-3,20-diol |
| Citations |
|---|