EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O2 |
| Net Charge | 0 |
| Average Mass | 428.701 |
| Monoisotopic Mass | 428.36543 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@@](C)(O)/C=C/[C@@H](CC)C(C)C |
| InChI | InChI=1S/C29H48O2/c1-7-20(19(2)3)12-17-29(6,31)26-11-10-24-23-9-8-21-18-22(30)13-15-27(21,4)25(23)14-16-28(24,26)5/h8,12,17,19-20,22-26,30-31H,7,9-11,13-16,18H2,1-6H3/b17-12+/t20-,22+,23+,24+,25+,26+,27+,28+,29+/m1/s1 |
| InChIKey | RFCDBEXZIQZKRG-WSCQTVFPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leucas urticifolia (ncbitaxon:483843) | whole plant (BTO:0001461) | PubMed (18787788) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leucisterol (CHEBI:66571) has parent hydride stigmastane (CHEBI:26773) |
| leucisterol (CHEBI:66571) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| leucisterol (CHEBI:66571) has role metabolite (CHEBI:25212) |
| leucisterol (CHEBI:66571) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| leucisterol (CHEBI:66571) is a 3β-sterol (CHEBI:35348) |
| leucisterol (CHEBI:66571) is a phytosterols (CHEBI:26125) |
| leucisterol (CHEBI:66571) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3β,22E)-stigmasta-5,22-diene-3,20-diol |
| Citations |
|---|