EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O5 |
| Net Charge | 0 |
| Average Mass | 350.370 |
| Monoisotopic Mass | 350.11542 |
| SMILES | COc1ccc2c(c1)OCc1c-2oc2c3c(c(O)cc12)OC(C)(C)C=C3 |
| InChI | InChI=1S/C21H18O5/c1-21(2)7-6-13-19-14(9-16(22)20(13)26-21)15-10-24-17-8-11(23-3)4-5-12(17)18(15)25-19/h4-9,22H,10H2,1-3H3 |
| InChIKey | AMXXXMGWYLGBLR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lespedeza floribunda (ncbitaxon:587870) | root (BTO:0001188) | PubMed (19132934) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lespeflorin H2 (CHEBI:66570) has role melanin synthesis inhibitor (CHEBI:64933) |
| lespeflorin H2 (CHEBI:66570) has role metabolite (CHEBI:25212) |
| lespeflorin H2 (CHEBI:66570) is a aromatic ether (CHEBI:35618) |
| lespeflorin H2 (CHEBI:66570) is a coumestans (CHEBI:72577) |
| lespeflorin H2 (CHEBI:66570) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 10-methoxy-3,3-dimethyl-3H,7H-furo[3,2-c:5,4-f']dichromen-5-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19089507 | Reaxys |
| Citations |
|---|