EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30O4 |
| Net Charge | 0 |
| Average Mass | 406.522 |
| Monoisotopic Mass | 406.21441 |
| SMILES | [H][C@@]12COc3c(ccc(O)c3CC=C(C)C)[C@]1([H])Oc1c2cc(C)c(O)c1CC=C(C)C |
| InChI | InChI=1S/C26H30O4/c1-14(2)6-8-17-22(27)11-10-19-24(17)29-13-21-20-12-16(5)23(28)18(9-7-15(3)4)25(20)30-26(19)21/h6-7,10-12,21,26-28H,8-9,13H2,1-5H3/t21-,26-/m0/s1 |
| InChIKey | XQHLJEHHIHCILO-LVXARBLLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lespedeza floribunda (ncbitaxon:587870) | root (BTO:0001188) | PubMed (19132934) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lespeflorin G5 (CHEBI:66567) has role melanin synthesis inhibitor (CHEBI:64933) |
| lespeflorin G5 (CHEBI:66567) has role plant metabolite (CHEBI:76924) |
| lespeflorin G5 (CHEBI:66567) is a phenols (CHEBI:33853) |
| lespeflorin G5 (CHEBI:66567) is a pterocarpans (CHEBI:26377) |
| IUPAC Name |
|---|
| (6aR,11aR)-8-methyl-4,10-bis(3-methylbut-2-en-1-yl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-3,9-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19089531 | Reaxys |
| Citations |
|---|