EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O5 |
| Net Charge | 0 |
| Average Mass | 356.418 |
| Monoisotopic Mass | 356.16237 |
| SMILES | COc1cc(O)c(CC=C(C)C)cc1C(=O)[C@@H](O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C21H24O5/c1-13(2)4-7-15-11-17(20(26-3)12-18(15)23)21(25)19(24)10-14-5-8-16(22)9-6-14/h4-6,8-9,11-12,19,22-24H,7,10H2,1-3H3/t19-/m0/s1 |
| InChIKey | XTDORSAGLFPXGX-IBGZPJMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lespedeza floribunda (ncbitaxon:587870) | root (BTO:0001188) | PubMed (19132934) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lespeflorin C3 (CHEBI:66564) has role melanin synthesis inhibitor (CHEBI:64933) |
| lespeflorin C3 (CHEBI:66564) has role metabolite (CHEBI:25212) |
| lespeflorin C3 (CHEBI:66564) is a dihydrochalcones (CHEBI:71230) |
| lespeflorin C3 (CHEBI:66564) is a monomethoxybenzene (CHEBI:25235) |
| lespeflorin C3 (CHEBI:66564) is a phenols (CHEBI:33853) |
| lespeflorin C3 (CHEBI:66564) is a secondary alcohol (CHEBI:35681) |
| lespeflorin C3 (CHEBI:66564) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-1-[4-hydroxy-2-methoxy-5-(3-methylbut-2-en-1-yl)phenyl]-3-(4-hydroxyphenyl)propan-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19089509 | Reaxys |
| Citations |
|---|