EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36O6 |
| Net Charge | 0 |
| Average Mass | 492.612 |
| Monoisotopic Mass | 492.25119 |
| SMILES | CC(C)=CCc1cc([C@H]2Oc3c(CC=C(C)C)c(O)c(CC=C(C)C)c(O)c3C(=O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C30H36O6/c1-16(2)7-10-19-15-20(11-14-23(19)31)29-28(35)27(34)24-26(33)21(12-8-17(3)4)25(32)22(30(24)36-29)13-9-18(5)6/h7-9,11,14-15,28-29,31-33,35H,10,12-13H2,1-6H3/t28-,29+/m0/s1 |
| InChIKey | HPUMCKZHBQPWBN-URLMMPGGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lespedeza floribunda (ncbitaxon:587870) | root (BTO:0001188) | PubMed (19132934) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lespeflorin B4 (CHEBI:66563) has functional parent (2S)-flavanone (CHEBI:15606) |
| lespeflorin B4 (CHEBI:66563) has role melanin synthesis inhibitor (CHEBI:64933) |
| lespeflorin B4 (CHEBI:66563) has role metabolite (CHEBI:25212) |
| lespeflorin B4 (CHEBI:66563) is a 4'-hydroxyflavanones (CHEBI:140331) |
| lespeflorin B4 (CHEBI:66563) is a dihydroflavonols (CHEBI:48039) |
| lespeflorin B4 (CHEBI:66563) is a secondary α-hydroxy ketone (CHEBI:2468) |
| lespeflorin B4 (CHEBI:66563) is a tetrahydroxyflavanone (CHEBI:38742) |
| IUPAC Name |
|---|
| (2R,3R)-3,5,7-trihydroxy-2-[4-hydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-6,8-bis(3-methylbut-2-en-1-yl)-2,3-dihydro-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19089538 | Reaxys |
| Citations |
|---|