EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34O4 |
| Net Charge | 0 |
| Average Mass | 458.598 |
| Monoisotopic Mass | 458.24571 |
| SMILES | CC(C)=CCc1cc2c(c(CC=C(C)C)c1O)O[C@H](c1ccc3c(c1)C=CC(C)(C)O3)CC2=O |
| InChI | InChI=1S/C30H34O4/c1-18(2)7-9-22-16-24-25(31)17-27(33-29(24)23(28(22)32)11-8-19(3)4)20-10-12-26-21(15-20)13-14-30(5,6)34-26/h7-8,10,12-16,27,32H,9,11,17H2,1-6H3/t27-/m0/s1 |
| InChIKey | SAZBMMMZQLNWMN-MHZLTWQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lespedeza floribunda (ncbitaxon:587870) | root (BTO:0001188) | PubMed (19132934) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lespeflorin A3 (CHEBI:66560) has role melanin synthesis inhibitor (CHEBI:64933) |
| lespeflorin A3 (CHEBI:66560) has role metabolite (CHEBI:25212) |
| lespeflorin A3 (CHEBI:66560) is a monohydroxyflavanone (CHEBI:38748) |
| IUPAC Name |
|---|
| (2S)-7-hydroxy-2',2'-dimethyl-6,8-bis(3-methylbut-2-en-1-yl)-2,3-dihydro-2'H,4H-2,6'-bichromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19089533 | Reaxys |
| Citations |
|---|