EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H38O2 |
| Net Charge | 0 |
| Average Mass | 430.632 |
| Monoisotopic Mass | 430.28718 |
| SMILES | [H][C@]12CC[C@@](C)(c3cc(-c4cc([C@]5(C)CC[C@]6([H])C[C@@]65C)c(O)cc4C)c(C)cc3O)[C@@]1(C)C2 |
| InChI | InChI=1S/C30H38O2/c1-17-11-25(31)23(27(3)9-7-19-15-29(19,27)5)13-21(17)22-14-24(26(32)12-18(22)2)28(4)10-8-20-16-30(20,28)6/h11-14,19-20,31-32H,7-10,15-16H2,1-6H3/t19-,20-,27+,28+,29+,30+/m1/s1 |
| InChIKey | XNIZFYLMUVNEOT-MUVIMXQCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laurencia nidifica (ncbitaxon:689809) | - | DOI (10.1016/S0031-9422(00)81142-5) | |
| Laurencia tristicha (WORMS:374064) | - | PubMed (15974618) |
| Roles Classification |
|---|
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| laurebiphenyl (CHEBI:66554) has role algal metabolite (CHEBI:84735) |
| laurebiphenyl (CHEBI:66554) has role antineoplastic agent (CHEBI:35610) |
| laurebiphenyl (CHEBI:66554) is a biphenyls (CHEBI:22888) |
| laurebiphenyl (CHEBI:66554) is a phenols (CHEBI:33853) |
| laurebiphenyl (CHEBI:66554) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| 5,5'-bis[(1S,2R,5R)-1,2-dimethylbicyclo[3.1.0]hex-2-yl]-2,2'-dimethylbiphenyl-4,4'-diol |
| Manual Xrefs | Databases |
|---|---|
| 9706857 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6539345 | Reaxys |
| Citations |
|---|