EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H27NO12 |
| Net Charge | 0 |
| Average Mass | 569.519 |
| Monoisotopic Mass | 569.15333 |
| SMILES | [H][C@]1(O[C@@]23CO[C@@]4(OC)CC(=O)O[C@]42C(=O)c2c(cc4cc(O)c5c(c4c2O)CN(C)C5=O)C3=O)CC[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C28H27NO12/c1-11-15(30)4-5-18(39-11)41-26-10-38-27(37-3)8-17(32)40-28(26,27)24(35)21-13(23(26)34)6-12-7-16(31)20-14(19(12)22(21)33)9-29(2)25(20)36/h6-7,11,15,18,30-31,33H,4-5,8-10H2,1-3H3/t11-,15-,18-,26+,27-,28-/m0/s1 |
| InChIKey | XFQJOLWXLJXJSV-VUAGTGNDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces rishiriensis (ncbitaxon:68264) | - | PubMed (8931735) | Strain: MJ773-88K4 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lactonamycin (CHEBI:66553) has functional parent L-rhodinose (CHEBI:32485) |
| lactonamycin (CHEBI:66553) has role antibacterial agent (CHEBI:33282) |
| lactonamycin (CHEBI:66553) has role antimicrobial agent (CHEBI:33281) |
| lactonamycin (CHEBI:66553) has role metabolite (CHEBI:25212) |
| lactonamycin (CHEBI:66553) is a organic heterohexacyclic compound (CHEBI:51914) |
| lactonamycin (CHEBI:66553) is a phenols (CHEBI:33853) |
| lactonamycin (CHEBI:66553) is a trideoxyhexose derivative (CHEBI:63349) |
| lactonamycin (CHEBI:66553) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aS,5aS,14aR)-9,13-dihydroxy-5a-{[(2S,5S,6S)-5-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-3a-methoxy-11-methyl-3,3a,11,12-tetrahydro-2H,5H-furo[2'',3'':4',5']furo[3',4':6,7]naphtho[2,3-e]isoindole-2,6,10,14(5aH)-tetrone |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8378497 | Reaxys |
| CAS:182234-02-2 | ChemIDplus |
| Citations |
|---|