EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)c(O)cc3C[C@@]1(O)CCCC2(C)C |
| InChI | InChI=1S/C20H30O2/c1-13(2)16-10-14-6-7-18-19(3,4)8-5-9-20(18,22)12-15(14)11-17(16)21/h10-11,13,18,21-22H,5-9,12H2,1-4H3/t18-,20-/m0/s1 |
| InChIKey | UZNOTFOFROXACM-ICSRJNTNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia lanigera (ITIS:832888) | root (BTO:0001188) | PubMed (8824952) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lanigerol (CHEBI:66549) has role antibacterial agent (CHEBI:33282) |
| lanigerol (CHEBI:66549) has role metabolite (CHEBI:25212) |
| lanigerol (CHEBI:66549) is a carbotricyclic compound (CHEBI:38032) |
| lanigerol (CHEBI:66549) is a diterpenoid (CHEBI:23849) |
| lanigerol (CHEBI:66549) is a phenols (CHEBI:33853) |
| lanigerol (CHEBI:66549) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (4aS,11aS)-1,1-dimethyl-8-(propan-2-yl)-1,2,3,4,5,10,11,11a-octahydro-4aH-dibenzo[a,d][7]annulene-4a,7-diol |
| Synonym | Source |
|---|---|
| 10,12-dihydroxy-9(10→20)-abeo 8,11,13-abietatriene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6062537 | Reaxys |
| Citations |
|---|