EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)c(O)cc3C[C@@]1(O)CCCC2(C)C |
| InChI | InChI=1S/C20H30O2/c1-13(2)16-10-14-6-7-18-19(3,4)8-5-9-20(18,22)12-15(14)11-17(16)21/h10-11,13,18,21-22H,5-9,12H2,1-4H3/t18-,20-/m0/s1 |
| InChIKey | UZNOTFOFROXACM-ICSRJNTNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia lanigera (ITIS:832888) | root (BTO:0001188) | PubMed (8824952) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lanigerol (CHEBI:66549) has role antibacterial agent (CHEBI:33282) |
| lanigerol (CHEBI:66549) has role metabolite (CHEBI:25212) |
| lanigerol (CHEBI:66549) is a carbotricyclic compound (CHEBI:38032) |
| lanigerol (CHEBI:66549) is a diterpenoid (CHEBI:23849) |
| lanigerol (CHEBI:66549) is a phenols (CHEBI:33853) |
| lanigerol (CHEBI:66549) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (4aS,11aS)-1,1-dimethyl-8-(propan-2-yl)-1,2,3,4,5,10,11,11a-octahydro-4aH-dibenzo[a,d][7]annulene-4a,7-diol |
| Synonym | Source |
|---|---|
| 10,12-dihydroxy-9(10→20)-abeo 8,11,13-abietatriene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6062537 | Reaxys |
| Citations |
|---|