EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H22NO11S.Na |
| Net Charge | 0 |
| Average Mass | 615.548 |
| Monoisotopic Mass | 615.08113 |
| SMILES | COc1ccc(-c2c3c4cc(OC)c(OS(=O)(=O)[O-])cc4oc(=O)c3n3ccc4cc(OC)c(OC)cc4c23)cc1O.[Na+] |
| InChI | InChI=1S/C29H23NO11S.Na/c1-36-19-6-5-15(9-18(19)31)25-26-17-12-23(39-4)24(41-42(33,34)35)13-20(17)40-29(32)28(26)30-8-7-14-10-21(37-2)22(38-3)11-16(14)27(25)30;/h5-13,31H,1-4H3,(H,33,34,35);/q;+1/p-1 |
| InChIKey | XFFQTURHMBFHKK-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| unclassified Ascidiacea (ncbitaxon:948983) | - | PubMed (10354398) | Ascidian (IIC-197) Strain: IIC-197 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lamellarin α 20-sulfate (CHEBI:66548) has part lamellarin α 20-sulfate(1−) (CHEBI:72791) |
| lamellarin α 20-sulfate (CHEBI:66548) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| lamellarin α 20-sulfate (CHEBI:66548) has role metabolite (CHEBI:25212) |
| lamellarin α 20-sulfate (CHEBI:66548) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 14-(3-hydroxy-4-methoxyphenyl)-2,11,12-trimethoxy-6-oxo-6H-chromeno[4',3':4,5]pyrrolo[2,1-a]isoquinolin-3-yl sulfate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8382319 | Reaxys |
| Citations |
|---|