EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H61NO8 |
| Net Charge | 0 |
| Average Mass | 659.905 |
| Monoisotopic Mass | 659.43972 |
| SMILES | [H][C@@]12CCC(=C)[C@H](CC[C@H]3C(C)=CC[C@@H](C(=C)C)[C@]3(C)CCC(=O)O)[C@@]1(C)CC[C@]([H])(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(C)=O)C2(C)C |
| InChI | InChI=1S/C38H61NO8/c1-21(2)25-12-10-22(3)26(37(25,8)19-17-31(42)43)13-14-27-23(4)11-15-29-36(6,7)30(16-18-38(27,29)9)47-35-32(39-24(5)41)34(45)33(44)28(20-40)46-35/h10,25-30,32-35,40,44-45H,1,4,11-20H2,2-3,5-9H3,(H,39,41)(H,42,43)/t25-,26-,27-,28+,29-,30-,32+,33+,34+,35-,37-,38+/m0/s1 |
| InChIKey | DPUBTAIUQYXFDA-RAWPCXBLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lansium domesticum (ncbitaxon:201017) | exocarp (BTO:0000733) | DOI (10.1021/jo00172a004) | Previous component: fruit peel; |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lansioside A (CHEBI:66545) has role leukotriene antagonist (CHEBI:49159) |
| lansioside A (CHEBI:66545) has role plant metabolite (CHEBI:76924) |
| lansioside A (CHEBI:66545) is a N-acetyl-D-glucosaminide (CHEBI:28401) |
| lansioside A (CHEBI:66545) is a monocarboxylic acid (CHEBI:25384) |
| lansioside A (CHEBI:66545) is a triterpenoid saponin (CHEBI:61778) |
| Manual Xrefs | Databases |
|---|---|
| 10268040 | ChemSpider |
| HMDB0035101 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4631506 | Reaxys |