EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H36O10 |
| Net Charge | 0 |
| Average Mass | 544.597 |
| Monoisotopic Mass | 544.23085 |
| SMILES | [H][C@@]12CCC3=C(O)[C@]45O[C@@]3(CC[C@]3(C)C(=O)[C@@H](C)[C@]([H])([C@]6(C[C@H](C)C(=O)O6)O4)[C@]53[H])C[C@@]13OC(=O)C[C@@]3([H])O[C@@]2(C)CO |
| InChI | InChI=1S/C29H36O10/c1-13-10-28(37-23(13)34)19-14(2)21(32)24(3)7-8-26-11-27-16(25(4,12-30)35-17(27)9-18(31)36-27)6-5-15(26)22(33)29(38-26,39-28)20(19)24/h13-14,16-17,19-20,30,33H,5-12H2,1-4H3/t13-,14-,16-,17+,19-,20-,24-,25-,26-,27+,28-,29+/m0/s1 |
| InChIKey | LTHLIQFAHGGQPW-OQURKPEFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schisandra lancifolia (ncbitaxon:238549) | |||
| leaf (BTO:0000713) | PubMed (15901155) | ||
| stem (BTO:0001300) | PubMed (15901155) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lancifodilactone G (CHEBI:66543) has role anti-HIV agent (CHEBI:64946) |
| lancifodilactone G (CHEBI:66543) has role metabolite (CHEBI:25212) |
| lancifodilactone G (CHEBI:66543) is a cyclic ether (CHEBI:37407) |
| lancifodilactone G (CHEBI:66543) is a diol (CHEBI:23824) |
| lancifodilactone G (CHEBI:66543) is a enol (CHEBI:33823) |
| lancifodilactone G (CHEBI:66543) is a oxaspiro compound (CHEBI:37948) |
| lancifodilactone G (CHEBI:66543) is a triterpenoid (CHEBI:36615) |
| lancifodilactone G (CHEBI:66543) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (2R,2aS,3S,4'S,4aS,6aS,7aR,10aR,12R,12aS,15aR,15bS)-15-hydroxy-12-(hydroxymethyl)-3,4',4a,12-tetramethyl-2a,3,3',4',4a,5,6,10,10a,12,12a,13,14,15b-tetradecahydro-4H,5'H,9H-spiro[6a,15a-epoxy-1,8,11-trioxacyclopenta[c]pentaleno[1',6':4,5,6]cycloocta[1,2-f]azulene-2,2'-furan]-4,5',9-trione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10138682 | Reaxys |
| Citations |
|---|