EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40O6 |
| Net Charge | 0 |
| Average Mass | 436.589 |
| Monoisotopic Mass | 436.28249 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@](C)(CC[C@]3([H])[C@H](C)C(=O)O)[C@@]1([H])CC[C@@]([H])([C@](C)(O)CO)[C@@]1(CCC(=O)O1)C2 |
| InChI | InChI=1S/C25H40O6/c1-15(21(28)29)17-8-11-23(3)18-5-6-19(24(4,30)14-26)25(12-9-20(27)31-25)13-16(18)7-10-22(17,23)2/h15-19,26,30H,5-14H2,1-4H3,(H,28,29)/t15-,16+,17+,18-,19-,22+,23-,24+,25+/m0/s1 |
| InChIKey | GFRDTMTUJTYIJJ-IUSUREMMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schisandra lancifolia (ncbitaxon:238549) | |||
| leaf (BTO:0000713) | PubMed (15787482) | ||
| stem (BTO:0001300) | PubMed (15787482) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lancifodilactone F (CHEBI:66542) has role anti-HIV agent (CHEBI:64946) |
| lancifodilactone F (CHEBI:66542) has role metabolite (CHEBI:25212) |
| lancifodilactone F (CHEBI:66542) is a diol (CHEBI:23824) |
| lancifodilactone F (CHEBI:66542) is a monocarboxylic acid (CHEBI:25384) |
| lancifodilactone F (CHEBI:66542) is a oxaspiro compound (CHEBI:37948) |
| lancifodilactone F (CHEBI:66542) is a tetracyclic triterpenoid (CHEBI:26893) |
| lancifodilactone F (CHEBI:66542) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (2S)-2-{(3R,3aR,5aR,7R,8S,10aS,10bS)-8-[(2S)-1,2-dihydroxypropan-2-yl]-3a,10b-dimethyl-5'-oxotetradecahydro-1H,3'H-spiro[cyclohepta[e]indene-7,2'-furan]-3-yl}propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10049664 | Reaxys |
| Citations |
|---|